* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(7-CHLORO-2H-1,3-BENZODIOXOL-5-YL)-1-ETHYL-1H-IMIDAZOL-5-AMINE |
English Synonyms: | 4-(7-CHLORO-2H-1,3-BENZODIOXOL-5-YL)-1-ETHYL-1H-IMIDAZOL-5-AMINE |
MDL Number.: | MFCD15513465 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCn1cnc(c1N)c2cc3c(c(c2)Cl)OCO3 |
InChi: | InChI=1S/C12H12ClN3O2/c1-2-16-5-15-10(12(16)14)7-3-8(13)11-9(4-7)17-6-18-11/h3-5H,2,6,14H2,1H3 |
InChiKey: | InChIKey=OPTHWSZRVVHSSD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.