* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)-1-ETHYL-1H-IMIDAZOL-5-AMINE |
English Synonyms: | 4-(2,3-DIHYDRO-1,4-BENZODIOXIN-6-YL)-1-ETHYL-1H-IMIDAZOL-5-AMINE |
MDL Number.: | MFCD15513466 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCn1cnc(c1N)c2ccc3c(c2)OCCO3 |
InChi: | InChI=1S/C13H15N3O2/c1-2-16-8-15-12(13(16)14)9-3-4-10-11(7-9)18-6-5-17-10/h3-4,7-8H,2,5-6,14H2,1H3 |
InChiKey: | InChIKey=HYCWIPIOXKGPRG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.