* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(3,3-DIMETHYL-2-OXOBUTYL)-2-METHYL-3,4-DIHYDRO-2H-1,4-BENZOXAZIN-3-ONE |
| English Synonyms: | 4-(3,3-DIMETHYL-2-OXOBUTYL)-2-METHYL-3,4-DIHYDRO-2H-1,4-BENZOXAZIN-3-ONE |
| MDL Number.: | MFCD15515062 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CC1C(=O)N(c2ccccc2O1)CC(=O)C(C)(C)C |
| InChi: | InChI=1S/C15H19NO3/c1-10-14(18)16(9-13(17)15(2,3)4)11-7-5-6-8-12(11)19-10/h5-8,10H,9H2,1-4H3 |
| InChiKey: | InChIKey=VHTREDGIEYLYNQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.