* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-[2-(1-METHYL-1H-PYRROL-3-YL)-2-OXOETHYL]MORPHOLINE-3,5-DIONE |
English Synonyms: | 4-[2-(1-METHYL-1H-PYRROL-3-YL)-2-OXOETHYL]MORPHOLINE-3,5-DIONE |
MDL Number.: | MFCD15515623 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | Cn1ccc(c1)C(=O)CN2C(=O)COCC2=O |
InChi: | InChI=1S/C11H12N2O4/c1-12-3-2-8(4-12)9(14)5-13-10(15)6-17-7-11(13)16/h2-4H,5-7H2,1H3 |
InChiKey: | InChIKey=DHFKQZRQOKKBEY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.