* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-CHLORO-3-(7-METHYL-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-YL)ANILINE |
| English Synonyms: | 4-CHLORO-3-(7-METHYL-[1,2,4]TRIAZOLO[4,3-C]PYRIMIDIN-3-YL)ANILINE |
| MDL Number.: | MFCD15522491 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1cc2nnc(n2cn1)c3cc(ccc3Cl)N |
| InChi: | InChI=1S/C12H10ClN5/c1-7-4-11-16-17-12(18(11)6-15-7)9-5-8(14)2-3-10(9)13/h2-6H,14H2,1H3 |
| InChiKey: | InChIKey=UMKNLPPXUMYIED-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.