* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(1-ETHYL-1H-1,3-BENZODIAZOL-2-YL)-2-METHYLBUTAN-2-AMINE |
| English Synonyms: | 4-(1-ETHYL-1H-1,3-BENZODIAZOL-2-YL)-2-METHYLBUTAN-2-AMINE |
| MDL Number.: | MFCD15522915 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCn1c2ccccc2nc1CCC(C)(C)N |
| InChi: | InChI=1S/C14H21N3/c1-4-17-12-8-6-5-7-11(12)16-13(17)9-10-14(2,3)15/h5-8H,4,9-10,15H2,1-3H3 |
| InChiKey: | InChIKey=JKHDNTZVUXBBQD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.