* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(5,6-DIFLUORO-1H-1,3-BENZODIAZOL-2-YL)-2-METHYLBUTAN-2-AMINE |
| English Synonyms: | 4-(5,6-DIFLUORO-1H-1,3-BENZODIAZOL-2-YL)-2-METHYLBUTAN-2-AMINE |
| MDL Number.: | MFCD15522920 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CC(C)(CCc1[nH]c2cc(c(cc2n1)F)F)N |
| InChi: | InChI=1S/C12H15F2N3/c1-12(2,15)4-3-11-16-9-5-7(13)8(14)6-10(9)17-11/h5-6H,3-4,15H2,1-2H3,(H,16,17) |
| InChiKey: | InChIKey=CBXGNEUYBNFFIF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.