* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(1,5-DIMETHYL-1H-1,3-BENZODIAZOL-2-YL)-2-METHYLBUTAN-2-AMINE |
English Synonyms: | 4-(1,5-DIMETHYL-1H-1,3-BENZODIAZOL-2-YL)-2-METHYLBUTAN-2-AMINE |
MDL Number.: | MFCD15522921 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1ccc2c(c1)nc(n2C)CCC(C)(C)N |
InChi: | InChI=1S/C14H21N3/c1-10-5-6-12-11(9-10)16-13(17(12)4)7-8-14(2,3)15/h5-6,9H,7-8,15H2,1-4H3 |
InChiKey: | InChIKey=DWBUFCVLBQKHRD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.