* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-[5-CHLORO-1-(PROPAN-2-YL)-1H-1,3-BENZODIAZOL-2-YL]-2-METHYLBUTAN-2-AMINE |
| English Synonyms: | 4-[5-CHLORO-1-(PROPAN-2-YL)-1H-1,3-BENZODIAZOL-2-YL]-2-METHYLBUTAN-2-AMINE |
| MDL Number.: | MFCD15522934 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)n1c2ccc(cc2nc1CCC(C)(C)N)Cl |
| InChi: | InChI=1S/C15H22ClN3/c1-10(2)19-13-6-5-11(16)9-12(13)18-14(19)7-8-15(3,4)17/h5-6,9-10H,7-8,17H2,1-4H3 |
| InChiKey: | InChIKey=ODSXHXGEBBQOAX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.