* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(5-CYCLOHEXYL-1H-1,2,4-TRIAZOL-3-YL)-2-METHYLBUTAN-2-AMINE |
| English Synonyms: | 4-(5-CYCLOHEXYL-1H-1,2,4-TRIAZOL-3-YL)-2-METHYLBUTAN-2-AMINE |
| MDL Number.: | MFCD15523276 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(C)(CCc1nc([nH]n1)C2CCCCC2)N |
| InChi: | InChI=1S/C13H24N4/c1-13(2,14)9-8-11-15-12(17-16-11)10-6-4-3-5-7-10/h10H,3-9,14H2,1-2H3,(H,15,16,17) |
| InChiKey: | InChIKey=OJADODAPOQPVRW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.