* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(5-AMINO-4-METHYL-1,2-OXAZOL-3-YL)PHENOL |
| English Synonyms: | 4-(5-AMINO-4-METHYL-ISOXAZOL-3-YL)-PHENOL ; 4-(5-AMINO-4-METHYL-1,2-OXAZOL-3-YL)PHENOL |
| MDL Number.: | MFCD15523702 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | Cc1c(noc1N)c2ccc(cc2)O |
| InChi: | InChI=1S/C10H10N2O2/c1-6-9(12-14-10(6)11)7-2-4-8(13)5-3-7/h2-5,13H,11H2,1H3 |
| InChiKey: | InChIKey=BTWZMLFKEVUPQI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.