* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-METHYL-5-(2-NITRO-PHENYL)-2,4-DIHYDRO-[1,2,4]TRIAZOLE-3-THIONE |
English Synonyms: | 4-METHYL-5-(2-NITRO-PHENYL)-2,4-DIHYDRO-[1,2,4]TRIAZOLE-3-THIONE |
MDL Number.: | MFCD15525193 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CN1C(NN=C1C1=C(C=CC=C1)[N+](=O)[O-])=S |
InChi: | InChI=1S/C9H8N4O2S/c1-12-8(10-11-9(12)16)6-4-2-3-5-7(6)13(14)15/h2-5H,1H3,(H,11,16) |
InChiKey: | InChIKey=GQDNSQHPDKFEQQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.