* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-CHLORO-5,6,7,8-TETRAHYDRO-9-THIA-1,3,7-TRIAZA-FLUORENE |
| CAS: | 951035-45-3 |
| English Synonyms: | 4-CHLORO-5,6,7,8-TETRAHYDRO-9-THIA-1,3,7-TRIAZA-FLUORENE |
| MDL Number.: | MFCD15527003 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1nc2c(c3c(s2)CNCC3)c(n1)Cl |
| InChi: | InChI=1S/C9H8ClN3S/c10-8-7-5-1-2-11-3-6(5)14-9(7)13-4-12-8/h4,11H,1-3H2 |
| InChiKey: | InChIKey=NCZJULQHIYTNLO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.