* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-IODOQUINAZOLIN-4-OL |
| CAS: | 77150-36-8 |
| English Synonyms: | 4(3H)-QUINAZOLINONE, 8-IODO- ; 8-IODOQUINAZOLIN-4-OL |
| MDL Number.: | MFCD15527387 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc2c(c(c1)I)ncnc2O |
| InChi: | InChI=1S/C8H5IN2O/c9-6-3-1-2-5-7(6)10-4-11-8(5)12/h1-4H,(H,10,11,12) |
| InChiKey: | InChIKey=ZCDKMEWIBQJRGA-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.