* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(4-AMINO-3-ETHYL-PHENYL)-MORPHOLIN-3-ONE |
English Synonyms: | 4-(4-AMINO-3-ETHYL-PHENYL)-MORPHOLIN-3-ONE |
MDL Number.: | MFCD15527732 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCc1cc(ccc1N)N2CCOCC2=O |
InChi: | InChI=1S/C12H16N2O2/c1-2-9-7-10(3-4-11(9)13)14-5-6-16-8-12(14)15/h3-4,7H,2,5-6,8,13H2,1H3 |
InChiKey: | InChIKey=KDQTWUQWUGXJHA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.