* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(5-AMINOPYRIDIN-2-YL)MORPHOLIN-3-ONE |
English Synonyms: | ABBYPHARMA AP-31-3146 ; 4-(5-AMINOPYRIDIN-2-YL)MORPHOLIN-3-ONE |
MDL Number.: | MFCD15527818 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc(ncc1N)N2CCOCC2=O |
InChi: | InChI=1S/C9H11N3O2/c10-7-1-2-8(11-5-7)12-3-4-14-6-9(12)13/h1-2,5H,3-4,6,10H2 |
InChiKey: | InChIKey=KDHNBVKJDJZDKQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.