* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(4-AMINO-PHENYL)-PYRROLIDIN-2-ONE |
| English Synonyms: | 4-(4-AMINO-PHENYL)-PYRROLIDIN-2-ONE |
| MDL Number.: | MFCD15527838 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1cc(ccc1C2CC(=O)NC2)N |
| InChi: | InChI=1S/C10H12N2O/c11-9-3-1-7(2-4-9)8-5-10(13)12-6-8/h1-4,8H,5-6,11H2,(H,12,13) |
| InChiKey: | InChIKey=KHWGWQQVNONIPZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.