* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(4-AMINOPYRIDIN-2-YL)PIPERIDIN-2-ONE |
English Synonyms: | 4-(4-AMINOPYRIDIN-2-YL)PIPERIDIN-2-ONE |
MDL Number.: | MFCD15528051 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cnc(cc1N)C2CCNC(=O)C2 |
InChi: | InChI=1S/C10H13N3O/c11-8-2-4-12-9(6-8)7-1-3-13-10(14)5-7/h2,4,6-7H,1,3,5H2,(H2,11,12)(H,13,14) |
InChiKey: | InChIKey=VJJKTUAZRSRRTA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.