* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-((1R)-1-AMINO-2-HYDROXYETHYL)-3-IODOPHENOL |
English Synonyms: | 4-((1R)-1-AMINO-2-HYDROXYETHYL)-3-IODOPHENOL |
MDL Number.: | MFCD15530009 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | c1cc(c(cc1O)I)[C@H](CO)N |
InChi: | InChI=1S/C8H10INO2/c9-7-3-5(12)1-2-6(7)8(10)4-11/h1-3,8,11-12H,4,10H2/t8-/m0/s1 |
InChiKey: | InChIKey=HQVDKWIJODENAL-QMMMGPOBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.