* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(1H-PYRAZOL-3-YL)-1,2,3,4-TETRAHYDROQUINOLINE |
English Synonyms: | 4-(1H-PYRAZOL-3-YL)-1,2,3,4-TETRAHYDROQUINOLINE |
MDL Number.: | MFCD15530231 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)C(CCN2)c3cc[nH]n3 |
InChi: | InChI=1S/C12H13N3/c1-2-4-11-9(3-1)10(5-7-13-11)12-6-8-14-15-12/h1-4,6,8,10,13H,5,7H2,(H,14,15) |
InChiKey: | InChIKey=VTHYMQJYAFJODD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.