* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(6-FLUORO-3-OXO-2,3-DIHYDRO-4H-1,4-BENZOXAZIN-4-YL)BUTANOIC ACID |
| English Synonyms: | 4-(6-FLUORO-3-OXO-2,3-DIHYDRO-4H-1,4-BENZOXAZIN-4-YL)BUTANOIC ACID |
| MDL Number.: | MFCD15730193 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1cc2c(cc1F)N(C(=O)CO2)CCCC(=O)O |
| InChi: | InChI=1S/C12H12FNO4/c13-8-3-4-10-9(6-8)14(11(15)7-18-10)5-1-2-12(16)17/h3-4,6H,1-2,5,7H2,(H,16,17) |
| InChiKey: | InChIKey=ZVQWILAHCMISTB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.