* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,4,4-TRIFLUORO-1-(3-METHYL-4-NITRO-PHENYL)-BUTANE-1,3-DIONE |
CAS: | 864449-85-4 |
English Synonyms: | 4,4,4-TRIFLUORO-1-(3-METHYL-4-NITRO-PHENYL)-BUTANE-1,3-DIONE |
MDL Number.: | MFCD15833159 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | FC(C(CC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])C)=O)(F)F |
InChi: | InChI=1S/C11H8F3NO4/c1-6-4-7(2-3-8(6)15(18)19)9(16)5-10(17)11(12,13)14/h2-4H,5H2,1H3 |
InChiKey: | InChIKey=SGTMOGGRUXSKOG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.