* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PHTHALAZNIE, 1,4-DICHLORO-6-NITRO |
| CAS: | 159275-52-2 |
| English Synonyms: | PHTHALAZNIE, 1,4-DICHLORO-6-NITRO |
| MDL Number.: | MFCD16037288 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | c1cc2c(cc1[N+](=O)[O-])c(nnc2Cl)Cl |
| InChi: | InChI=1S/C8H3Cl2N3O2/c9-7-5-2-1-4(13(14)15)3-6(5)8(10)12-11-7/h1-3H |
| InChiKey: | InChIKey=NVBIMKGUWIFRHF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.