* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | YM-201636 |
| CAS: | 371942-69-7 |
| English Synonyms: | 6-AMINO-N-[3-[4-(4-MORPHOLINYL)PYRIDO[3',2':4,5]FURO[3,2-D]PYRIMIDIN-2-YL]PHENYL]-3-PYRIDINECARBOXAMIDE ; YM-201636 ; YM201636 |
| MDL Number.: | MFCD16038303 |
| H bond acceptor: | 10 |
| H bond donor: | 2 |
| Smile: | c1cc(cc(c1)NC(=O)c2ccc(nc2)N)c3nc4c5cccnc5oc4c(n3)N6CCOCC6 |
| InChi: | InChI=1S/C25H21N7O3/c26-19-7-6-16(14-28-19)24(33)29-17-4-1-3-15(13-17)22-30-20-18-5-2-8-27-25(18)35-21(20)23(31-22)32-9-11-34-12-10-32/h1-8,13-14H,9-12H2,(H2,26,28)(H,29,33) |
| InChiKey: | InChIKey=YBPIBGNBHHGLEB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.