* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PHENYLGERMATRANE |
| CAS: | 17663-22-8 |
| English Synonyms: | PHENYLGERMATRANE |
| MDL Number.: | MFCD16038424 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)[Ge]23OCCN(CCO2)CCO3 |
| InChi: | InChI=1S/C12H17GeNO3/c1-2-4-12(5-3-1)13-15-9-6-14(7-10-16-13)8-11-17-13/h1-5H,6-11H2 |
| InChiKey: | InChIKey=MEVPQSWYVLAQLI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.