Molecular Structure:
CCD No.:CCD02500341
PF 477736 HCL
CAS No.:
952238-93-6
Formula:C22 H25 N7 O2 . Cl H
MolWeight:455.947
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | PF 477736 HCL |
| CAS： | 952238-93-6 |
| English Synonyms： | PF-477736 HYDROCHLORIDE ; PF 477736 HCL |
| MDL Number.： | MFCD16038846 |
| H bond acceptor： | 9 |
| H bond donor： | 4 |
| Smile： | Cn1cc(cn1)c2c3c4c(cc(cc4[nH]2)NC(=O)[C@@H](C5CCCCC5)N)C(=O)NN=C3.Cl |
| InChi： | InChI=1S/C22H25N7O2.ClH/c1-29-11-13(9-25-29)20-16-10-24-28-21(30)15-7-14(8-17(27-20)18(15)16)26-22(31)19(23)12-5-3-2-4-6-12;/h7-12,19,27H,2-6,23H2,1H3,(H,26,31)(H,28,30);1H/t19-;/m1./s1 |
| InChiKey： | InChIKey=HBABNFFETJBQJP-FSRHSHDFSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
