* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PHENOL, 3,3'-(2,4-DIAMINO-6,7-PTERIDINEDIYL)BIS-, (H2SO4 SLAT) |
| CAS: | 677298-35-0 |
| English Synonyms: | PHENOL, 3,3'-(2,4-DIAMINO-6,7-PTERIDINEDIYL)BIS-, (H2SO4 SLAT) |
| MDL Number.: | MFCD16038875 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | c1cc(cc(c1)O)c2c(nc3c(n2)c(nc(n3)N)N)c4cccc(c4)O.OS(=O)(=O)O |
| InChi: | InChI=1S/C18H14N6O2.H2O4S/c19-16-15-17(24-18(20)23-16)22-14(10-4-2-6-12(26)8-10)13(21-15)9-3-1-5-11(25)7-9;1-5(2,3)4/h1-8,25-26H,(H4,19,20,22,23,24);(H2,1,2,3,4) |
| InChiKey: | InChIKey=BEYLJAIYTQDLAJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.