* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | YM-60828 (2HCL SALT) |
| CAS: | 179755-65-8 |
| English Synonyms: | YM-60828 (2HCL SALT) |
| MDL Number.: | MFCD16038923 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | Cc1ccc(cc1)S(=O)(=O)N2CC(=O)CCc3c2cccc3.Cl.Cl |
| InChi: | InChI=1S/C17H17NO3S.2ClH/c1-13-6-10-16(11-7-13)22(20,21)18-12-15(19)9-8-14-4-2-3-5-17(14)18;;/h2-7,10-11H,8-9,12H2,1H3;2*1H |
| InChiKey: | InChIKey=XYBMIOXVUSDDRK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.