* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | YM-60828 (MSOH SALT) |
| CAS: | 209187-02-0 |
| English Synonyms: | YM-60828 (MSOH SALT) |
| MDL Number.: | MFCD16038925 |
| H bond acceptor: | 10 |
| H bond donor: | 4 |
| Smile: | CC(=N)N1CCC(CC1)Oc2ccc(cc2)N(Cc3ccc4ccc(cc4c3)C(=N)N)S(=O)(=O)CC(=O)O.CS(=O)(=O)O |
| InChi: | InChI=1S/C27H31N5O5S.CH4O3S/c1-18(28)31-12-10-25(11-13-31)37-24-8-6-23(7-9-24)32(38(35,36)17-26(33)34)16-19-2-3-20-4-5-21(27(29)30)15-22(20)14-19;1-5(2,3)4/h2-9,14-15,25,28H,10-13,16-17H2,1H3,(H3,29,30)(H,33,34);1H3,(H,2,3,4) |
| InChiKey: | InChIKey=YRIFGKTUAWTSFP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.