* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PROPAN-2-YL 2-(1H-1,2,4-TRIAZOL-5-YLSULFANYL)ACETATE |
English Synonyms: | PROPAN-2-YL 2-(1H-1,2,4-TRIAZOL-5-YLSULFANYL)ACETATE |
MDL Number.: | MFCD16040342 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(C)OC(=O)CSc1[nH]ncn1 |
InChi: | InChI=1S/C7H11N3O2S/c1-5(2)12-6(11)3-13-7-8-4-9-10-7/h4-5H,3H2,1-2H3,(H,8,9,10) |
InChiKey: | InChIKey=CPXUBGSUARRRDR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.