* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPAN-2-YL 2-(4-IODOPHENOXY)ACETATE |
| CAS: | 1248291-23-7 |
| English Synonyms: | PROPAN-2-YL 2-(4-IODOPHENOXY)ACETATE |
| MDL Number.: | MFCD16040586 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CC(C)OC(=O)COc1ccc(cc1)I |
| InChi: | InChI=1S/C11H13IO3/c1-8(2)15-11(13)7-14-10-5-3-9(12)4-6-10/h3-6,8H,7H2,1-2H3 |
| InChiKey: | InChIKey=VMZLGLMIFWOGRG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.