* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPAN-2-YL (2R)-2-AMINOPROPANOATE |
| English Synonyms: | PROPAN-2-YL (2R)-2-AMINOPROPANOATE |
| MDL Number.: | MFCD16050805 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)OC(=O)[C@@H](C)N |
| InChi: | InChI=1S/C6H13NO2/c1-4(2)9-6(8)5(3)7/h4-5H,7H2,1-3H3/t5-/m1/s1 |
| InChiKey: | InChIKey=QDQVXVRZVCTVHE-RXMQYKEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.