* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPAN-2-YL 2-[(PENTAN-3-YL)AMINO]ACETATE |
| English Synonyms: | PROPAN-2-YL 2-[(PENTAN-3-YL)AMINO]ACETATE |
| MDL Number.: | MFCD16072960 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCC(CC)NCC(=O)OC(C)C |
| InChi: | InChI=1S/C10H21NO2/c1-5-9(6-2)11-7-10(12)13-8(3)4/h8-9,11H,5-7H2,1-4H3 |
| InChiKey: | InChIKey=OWMPTSVIIFTFPK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.