* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPAN-2-YL 2-(OCTAN-2-YLOXY)ACETATE |
| English Synonyms: | PROPAN-2-YL 2-(OCTAN-2-YLOXY)ACETATE |
| MDL Number.: | MFCD16073200 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCCCCCC(C)OCC(=O)OC(C)C |
| InChi: | InChI=1S/C13H26O3/c1-5-6-7-8-9-12(4)15-10-13(14)16-11(2)3/h11-12H,5-10H2,1-4H3 |
| InChiKey: | InChIKey=BXBFKMSBCOYDTR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.