* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPAN-2-YL 2-(PROP-2-EN-1-YLOXY)ACETATE |
| English Synonyms: | PROPAN-2-YL 2-(PROP-2-EN-1-YLOXY)ACETATE |
| MDL Number.: | MFCD16073213 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CC(C)OC(=O)COCC=C |
| InChi: | InChI=1S/C8H14O3/c1-4-5-10-6-8(9)11-7(2)3/h4,7H,1,5-6H2,2-3H3 |
| InChiKey: | InChIKey=YJAYVSPRRASJBV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.