* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-(3-AMINO-2-METHYLPROPYL)-9H-PURIN-6-AMINE |
| English Synonyms: | 9-(3-AMINO-2-METHYLPROPYL)-9H-PURIN-6-AMINE |
| MDL Number.: | MFCD16074136 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC(CN)Cn1cnc2c1ncnc2N |
| InChi: | InChI=1S/C9H14N6/c1-6(2-10)3-15-5-14-7-8(11)12-4-13-9(7)15/h4-6H,2-3,10H2,1H3,(H2,11,12,13) |
| InChiKey: | InChIKey=PYQPXGFGJAFUFT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.