* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-(PROP-2-YN-1-YL)-9H-PURIN-6-AMINE |
| English Synonyms: | 9-(PROP-2-YN-1-YL)-9H-PURIN-6-AMINE |
| MDL Number.: | MFCD16074154 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | C#CCn1cnc2c1ncnc2N |
| InChi: | InChI=1S/C8H7N5/c1-2-3-13-5-12-6-7(9)10-4-11-8(6)13/h1,4-5H,3H2,(H2,9,10,11) |
| InChiKey: | InChIKey=NAVKZAZXCDIPTQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.