* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-[2-(METHYLAMINO)PROPYL]-2H,3H-[1,2,4]TRIAZOLO[4,3-A]PYRIDIN-3-ONE |
| English Synonyms: | 2-[2-(METHYLAMINO)PROPYL]-2H,3H-[1,2,4]TRIAZOLO[4,3-A]PYRIDIN-3-ONE |
| MDL Number.: | MFCD16099075 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(Cn1c(=O)n2ccccc2n1)NC |
| InChi: | InChI=1S/C10H14N4O/c1-8(11-2)7-14-10(15)13-6-4-3-5-9(13)12-14/h3-6,8,11H,7H2,1-2H3 |
| InChiKey: | InChIKey=HRWAKYHAOGFBFF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.