* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-(PYRROLIDIN-1-YL)-2,3-DIHYDRO-1H-INDEN-1-OL |
| English Synonyms: | 2-(PYRROLIDIN-1-YL)-2,3-DIHYDRO-1H-INDEN-1-OL |
| MDL Number.: | MFCD16100716 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)CC(C2O)N3CCCC3 |
| InChi: | InChI=1S/C13H17NO/c15-13-11-6-2-1-5-10(11)9-12(13)14-7-3-4-8-14/h1-2,5-6,12-13,15H,3-4,7-9H2 |
| InChiKey: | InChIKey=ISMATWVWTRGZDQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.