* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-(2,5-DIMETHYLMORPHOLIN-4-YL)PENTAN-3-OL |
| English Synonyms: | 2-(2,5-DIMETHYLMORPHOLIN-4-YL)PENTAN-3-OL |
| MDL Number.: | MFCD16101248 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCC(C(C)N1CC(OCC1C)C)O |
| InChi: | InChI=1S/C11H23NO2/c1-5-11(13)10(4)12-6-9(3)14-7-8(12)2/h8-11,13H,5-7H2,1-4H3 |
| InChiKey: | InChIKey=HCTZTWUDLPGNCZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.