* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(3,5-DIMETHYL-1H-PYRAZOL-1-YL)CYCLOHEPTAN-1-OL |
English Synonyms: | 2-(3,5-DIMETHYL-1H-PYRAZOL-1-YL)CYCLOHEPTAN-1-OL |
MDL Number.: | MFCD16101800 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1cc(n(n1)C2CCCCCC2O)C |
InChi: | InChI=1S/C12H20N2O/c1-9-8-10(2)14(13-9)11-6-4-3-5-7-12(11)15/h8,11-12,15H,3-7H2,1-2H3 |
InChiKey: | InChIKey=KETNXVDWOZQXKE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.