* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(BENZYLOXY)CYCLOHEXAN-1-OL |
English Synonyms: | 2-(BENZYLOXY)CYCLOHEXAN-1-OL |
MDL Number.: | MFCD16102027 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)COC2CCCCC2O |
InChi: | InChI=1S/C13H18O2/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-3,6-7,12-14H,4-5,8-10H2 |
InChiKey: | InChIKey=OZOOGFVOCPMNTN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.