* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(BENZYLOXY)PENTAN-3-OL |
English Synonyms: | 2-(BENZYLOXY)PENTAN-3-OL |
MDL Number.: | MFCD16102028 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCC(C(C)OCc1ccccc1)O |
InChi: | InChI=1S/C12H18O2/c1-3-12(13)10(2)14-9-11-7-5-4-6-8-11/h4-8,10,12-13H,3,9H2,1-2H3 |
InChiKey: | InChIKey=YSEVMLVOZYRPFK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.