* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(TERT-BUTOXY)-1-(3,4-DIMETHYLPHENYL)ETHAN-1-OL |
English Synonyms: | 2-(TERT-BUTOXY)-1-(3,4-DIMETHYLPHENYL)ETHAN-1-OL |
MDL Number.: | MFCD16102536 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1ccc(cc1C)C(COC(C)(C)C)O |
InChi: | InChI=1S/C14H22O2/c1-10-6-7-12(8-11(10)2)13(15)9-16-14(3,4)5/h6-8,13,15H,9H2,1-5H3 |
InChiKey: | InChIKey=HJFLVRKMPIGJGW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.