* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-PROPOXYPENTAN-3-OL |
| English Synonyms: | 2-PROPOXYPENTAN-3-OL |
| MDL Number.: | MFCD16102716 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCOC(C)C(CC)O |
| InChi: | InChI=1S/C8H18O2/c1-4-6-10-7(3)8(9)5-2/h7-9H,4-6H2,1-3H3 |
| InChiKey: | InChIKey=ZDTMXUPOELDZKR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.