* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-PROPOXY-2,3-DIHYDRO-1H-INDEN-1-OL |
English Synonyms: | 2-PROPOXY-2,3-DIHYDRO-1H-INDEN-1-OL |
MDL Number.: | MFCD16102725 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCOC1Cc2ccccc2C1O |
InChi: | InChI=1S/C12H16O2/c1-2-7-14-11-8-9-5-3-4-6-10(9)12(11)13/h3-6,11-13H,2,7-8H2,1H3 |
InChiKey: | InChIKey=RYQYJZUZYINYSC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.