* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-BUTOXY-1-PHENYLBUTAN-1-OL |
English Synonyms: | 2-BUTOXY-1-PHENYLBUTAN-1-OL |
MDL Number.: | MFCD16102753 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCOC(CC)C(c1ccccc1)O |
InChi: | InChI=1S/C14H22O2/c1-3-5-11-16-13(4-2)14(15)12-9-7-6-8-10-12/h6-10,13-15H,3-5,11H2,1-2H3 |
InChiKey: | InChIKey=HKNFAZCKKCOYQQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.