* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-BUTOXYCYCLOHEPTAN-1-OL |
| English Synonyms: | 2-BUTOXYCYCLOHEPTAN-1-OL |
| MDL Number.: | MFCD16102769 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCCOC1CCCCCC1O |
| InChi: | InChI=1S/C11H22O2/c1-2-3-9-13-11-8-6-4-5-7-10(11)12/h10-12H,2-9H2,1H3 |
| InChiKey: | InChIKey=GESDOOCIZRYQCI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.