* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-BUTOXY-1-(2,5-DIMETHYLPHENYL)ETHAN-1-OL |
| English Synonyms: | 2-BUTOXY-1-(2,5-DIMETHYLPHENYL)ETHAN-1-OL |
| MDL Number.: | MFCD16102771 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCCOCC(c1cc(ccc1C)C)O |
| InChi: | InChI=1S/C14H22O2/c1-4-5-8-16-10-14(15)13-9-11(2)6-7-12(13)3/h6-7,9,14-15H,4-5,8,10H2,1-3H3 |
| InChiKey: | InChIKey=WAGWLKXWJIWLPD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.