* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-BUTOXY-1-(2,4-DIMETHYLPHENYL)ETHAN-1-OL |
English Synonyms: | 2-BUTOXY-1-(2,4-DIMETHYLPHENYL)ETHAN-1-OL |
MDL Number.: | MFCD16102776 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCOCC(c1ccc(cc1C)C)O |
InChi: | InChI=1S/C14H22O2/c1-4-5-8-16-10-14(15)13-7-6-11(2)9-12(13)3/h6-7,9,14-15H,4-5,8,10H2,1-3H3 |
InChiKey: | InChIKey=SHRBDGKADZALKU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.